C20H42O2 — CID 135029927
(2R,3S,4R)-2,4,16-trimethylheptadecane-1,3-diol (PubChem CID 135029927) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is (2R,3S,4R)-2,4,16-trimethylheptadecane-1,3-diol.
| Compound Name | (2R,3S,4R)-2,4,16-trimethylheptadecane-1,3-diol |
|---|---|
| PubChem CID | 135029927 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | (2R,3S,4R)-2,4,16-trimethylheptadecane-1,3-diol |
| SMILES | CC(C)CCCCCCCCCCC[C@@H](C)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C20H42O2/c1-17(2)14-12-10-8-6-5-7-9-11-13-15-18(3)20(22)19(4)16-21/h17-22H,5-16H2,1-4H3/t18-,19-,20+/m1/s1 |
| InChIKey | PNLMYOQNKZJCBC-AQNXPRMDSA-N |
| XLogP | 5.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|