About methane;2-methylnonadecan-3-ol;propan-2-ol
methane;2-methylnonadecan-3-ol;propan-2-ol (PubChem CID 160801493) has the molecular formula C24H54O2
and a molecular weight of 374.69 g/mol. Its IUPAC name is methane;2-methylnonadecan-3-ol;propan-2-ol.
Molecular Properties
| Compound Name | methane;2-methylnonadecan-3-ol;propan-2-ol |
| PubChem CID | 160801493 |
| Molecular Formula | C24H54O2 |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 374.41 |
| IUPAC Name | methane;2-methylnonadecan-3-ol;propan-2-ol |
| SMILES | C.CC(C)O.CCCCCCCCCCCCCCCCC(O)C(C)C |
| InChI | InChI=1S/C20H42O.C3H8O.CH4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(21)19(2)3;1-3(2)4;/h19-21H,4-18H2,1-3H3;3-4H,1-2H3;1H4 |
| InChIKey | SDCZPVZORAQPLI-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylnonadecan-3-ol;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylnonadecan-3-ol;propan-2-ol?
The IUPAC name of methane;2-methylnonadecan-3-ol;propan-2-ol (CID 160801493) is methane;2-methylnonadecan-3-ol;propan-2-ol.
What is the SMILES notation for methane;2-methylnonadecan-3-ol;propan-2-ol?
The canonical SMILES for methane;2-methylnonadecan-3-ol;propan-2-ol is C.CC(C)O.CCCCCCCCCCCCCCCCC(O)C(C)C.
What is the InChIKey of methane;2-methylnonadecan-3-ol;propan-2-ol?
The InChIKey is SDCZPVZORAQPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O.C3H8O.CH4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(21)19(2)3;1-3(2)4;/h19-21H,4-18H2,1-3H3;3-4H,1-2H3;1H4.
What are the key properties of methane;2-methylnonadecan-3-ol;propan-2-ol?
methane;2-methylnonadecan-3-ol;propan-2-ol has a molecular weight of 374.69 g/mol, XLogP of 7.90, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylnonadecan-3-ol;propan-2-ol is sourced from PubChem (CID 160801493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).