C19H38O4 — CID 141449008
2-(hydroxymethyl)-6-undec-10-enylheptane-1,4,7-triol (PubChem CID 141449008) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-undec-10-enylheptane-1,4,7-triol.
| Compound Name | 2-(hydroxymethyl)-6-undec-10-enylheptane-1,4,7-triol |
|---|---|
| PubChem CID | 141449008 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 2-(hydroxymethyl)-6-undec-10-enylheptane-1,4,7-triol |
| SMILES | C=CCCCCCCCCCC(CO)CC(O)CC(CO)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-17(14-20)12-19(23)13-18(15-21)16-22/h2,17-23H,1,3-16H2 |
| InChIKey | NFWYIRXBXMASRS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|