C10H34N2O12P4 — CID 21397790
hex-5-ene-1,1-diamine;methylphosphonic acid (PubChem CID 21397790) has the molecular formula C10H34N2O12P4 and a molecular weight of 498.28 g/mol. Its IUPAC name is hex-5-ene-1,1-diamine;methylphosphonic acid.
| Compound Name | hex-5-ene-1,1-diamine;methylphosphonic acid |
|---|---|
| PubChem CID | 21397790 |
| Molecular Formula | C10H34N2O12P4 |
| Molecular Weight | 498.28 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | hex-5-ene-1,1-diamine;methylphosphonic acid |
| SMILES | C=CCCCC(N)N.CP(=O)(O)O.CP(=O)(O)O.CP(=O)(O)O.CP(=O)(O)O |
| InChI | InChI=1S/C6H14N2.4CH5O3P/c1-2-3-4-5-6(7)8;4*1-5(2,3)4/h2,6H,1,3-5,7-8H2;4*1H3,(H2,2,3,4) |
| InChIKey | UYTCUPFDNQUGGA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 282.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|