C12H26O4P2 — CID 159912714
but-3-enyl(methyl)phosphinic acid;hex-5-enyl(methyl)phosphinic acid (PubChem CID 159912714) has the molecular formula C12H26O4P2 and a molecular weight of 296.28 g/mol. Its IUPAC name is but-3-enyl(methyl)phosphinic acid;hex-5-enyl(methyl)phosphinic acid.
| Compound Name | but-3-enyl(methyl)phosphinic acid;hex-5-enyl(methyl)phosphinic acid |
|---|---|
| PubChem CID | 159912714 |
| Molecular Formula | C12H26O4P2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | but-3-enyl(methyl)phosphinic acid;hex-5-enyl(methyl)phosphinic acid |
| SMILES | C=CCCCCP(C)(=O)O.C=CCCP(C)(=O)O |
| InChI | InChI=1S/C7H15O2P.C5H11O2P/c1-3-4-5-6-7-10(2,8)9;1-3-4-5-8(2,6)7/h3H,1,4-7H2,2H3,(H,8,9);3H,1,4-5H2,2H3,(H,6,7) |
| InChIKey | NXJORWKSQUTFNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|