About O-tridec-12-en-3-yl 2-methylpropanethioate
O-tridec-12-en-3-yl 2-methylpropanethioate (PubChem CID 56982072) has the molecular formula C17H32OS
and a molecular weight of 284.51 g/mol. Its IUPAC name is O-tridec-12-en-3-yl 2-methylpropanethioate.
Molecular Properties
| Compound Name | O-tridec-12-en-3-yl 2-methylpropanethioate |
| PubChem CID | 56982072 |
| Molecular Formula | C17H32OS |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | O-tridec-12-en-3-yl 2-methylpropanethioate |
| SMILES | C=CCCCCCCCCC(CC)OC(=S)C(C)C |
| InChI | InChI=1S/C17H32OS/c1-5-7-8-9-10-11-12-13-14-16(6-2)18-17(19)15(3)4/h5,15-16H,1,6-14H2,2-4H3 |
| InChIKey | FSBQWFLYWUHIPY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-tridec-12-en-3-yl 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-tridec-12-en-3-yl 2-methylpropanethioate?
The IUPAC name of O-tridec-12-en-3-yl 2-methylpropanethioate (CID 56982072) is O-tridec-12-en-3-yl 2-methylpropanethioate.
What is the SMILES notation for O-tridec-12-en-3-yl 2-methylpropanethioate?
The canonical SMILES for O-tridec-12-en-3-yl 2-methylpropanethioate is C=CCCCCCCCCC(CC)OC(=S)C(C)C.
What is the InChIKey of O-tridec-12-en-3-yl 2-methylpropanethioate?
The InChIKey is FSBQWFLYWUHIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32OS/c1-5-7-8-9-10-11-12-13-14-16(6-2)18-17(19)15(3)4/h5,15-16H,1,6-14H2,2-4H3.
What are the key properties of O-tridec-12-en-3-yl 2-methylpropanethioate?
O-tridec-12-en-3-yl 2-methylpropanethioate has a molecular weight of 284.51 g/mol, XLogP of 6.07, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-tridec-12-en-3-yl 2-methylpropanethioate is sourced from PubChem (CID 56982072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).