About O-heptadec-1-en-6-yl methylsulfanylmethanethioate
O-heptadec-1-en-6-yl methylsulfanylmethanethioate (PubChem CID 16741421) has the molecular formula C19H36OS2
and a molecular weight of 344.63 g/mol. Its IUPAC name is O-heptadec-1-en-6-yl methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-heptadec-1-en-6-yl methylsulfanylmethanethioate |
| PubChem CID | 16741421 |
| Molecular Formula | C19H36OS2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | O-heptadec-1-en-6-yl methylsulfanylmethanethioate |
| SMILES | C=CCCCC(CCCCCCCCCCC)OC(=S)SC |
| InChI | InChI=1S/C19H36OS2/c1-4-6-8-9-10-11-12-13-15-17-18(16-14-7-5-2)20-19(21)22-3/h5,18H,2,4,6-17H2,1,3H3 |
| InChIKey | UXUPELXRFIYXTJ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-heptadec-1-en-6-yl methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-heptadec-1-en-6-yl methylsulfanylmethanethioate?
The IUPAC name of O-heptadec-1-en-6-yl methylsulfanylmethanethioate (CID 16741421) is O-heptadec-1-en-6-yl methylsulfanylmethanethioate.
What is the SMILES notation for O-heptadec-1-en-6-yl methylsulfanylmethanethioate?
The canonical SMILES for O-heptadec-1-en-6-yl methylsulfanylmethanethioate is C=CCCCC(CCCCCCCCCCC)OC(=S)SC.
What is the InChIKey of O-heptadec-1-en-6-yl methylsulfanylmethanethioate?
The InChIKey is UXUPELXRFIYXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36OS2/c1-4-6-8-9-10-11-12-13-15-17-18(16-14-7-5-2)20-19(21)22-3/h5,18H,2,4,6-17H2,1,3H3.
What are the key properties of O-heptadec-1-en-6-yl methylsulfanylmethanethioate?
O-heptadec-1-en-6-yl methylsulfanylmethanethioate has a molecular weight of 344.63 g/mol, XLogP of 7.30, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-heptadec-1-en-6-yl methylsulfanylmethanethioate is sourced from PubChem (CID 16741421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).