C20H30O2S2 — CID 102520292
O-(11-phenylmethoxyundec-1-en-6-yl) methylsulfanylmethanethioate (PubChem CID 102520292) has the molecular formula C20H30O2S2 and a molecular weight of 366.59 g/mol. Its IUPAC name is O-(11-phenylmethoxyundec-1-en-6-yl) methylsulfanylmethanethioate.
| Compound Name | O-(11-phenylmethoxyundec-1-en-6-yl) methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 102520292 |
| Molecular Formula | C20H30O2S2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | O-(11-phenylmethoxyundec-1-en-6-yl) methylsulfanylmethanethioate |
| SMILES | C=CCCCC(CCCCCOCc1ccccc1)OC(=S)SC |
| InChI | InChI=1S/C20H30O2S2/c1-3-4-7-14-19(22-20(23)24-2)15-10-6-11-16-21-17-18-12-8-5-9-13-18/h3,5,8-9,12-13,19H,1,4,6-7,10-11,14-17H2,2H3 |
| InChIKey | YYAGRBJAADTKAO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|