C44H84N2O2 — CID 155096988
[3-(dimethylamino)propyl-methylamino]-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxymethanol (PubChem CID 155096988) has the molecular formula C44H84N2O2 and a molecular weight of 673.17 g/mol. Its IUPAC name is [3-(dimethylamino)propyl-methylamino]-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxymethanol.
| Compound Name | [3-(dimethylamino)propyl-methylamino]-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxymethanol |
|---|---|
| PubChem CID | 155096988 |
| Molecular Formula | C44H84N2O2 |
| Molecular Weight | 673.17 g/mol |
| Exact Mass | 672.65 |
| IUPAC Name | [3-(dimethylamino)propyl-methylamino]-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxymethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(O)N(C)CCCN(C)C |
| InChI | InChI=1S/C44H84N2O2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-43(48-44(47)46(5)42-38-41-45(3)4)40-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,43-44,47H,6-13,18-19,24-42H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | ORMAGJOPXZKXNR-ZPPAUJSGSA-N |
| XLogP | 12.94 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.17 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|