C40H76N2O2 — CID 130350685
N-[(5E,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl]peroxy-N',N'-dimethylethane-1,2-diamine (PubChem CID 130350685) has the molecular formula C40H76N2O2 and a molecular weight of 617.06 g/mol. Its IUPAC name is N-[(5E,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl]peroxy-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(5E,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl]peroxy-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130350685 |
| Molecular Formula | C40H76N2O2 |
| Molecular Weight | 617.06 g/mol |
| Exact Mass | 616.59 |
| IUPAC Name | N-[(5E,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl]peroxy-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCCC/C=C/C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OONCCN(C)C |
| InChI | InChI=1S/C40H76N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(43-44-41-38-39-42(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h12-15,18-21,40-41H,5-11,16-17,22-39H2,1-4H3/b14-12+,15-13-,20-18-,21-19- |
| InChIKey | CCQKEHZJUXAQHN-ZPZGWTTBSA-N |
| XLogP | 12.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.06 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|