C39H73NO4P- — CID 168800483
2-(dimethylamino)ethyl [(5Z,8Z,27Z,30Z)-pentatriaconta-5,8,27,30-tetraen-18-yl] phosphate (PubChem CID 168800483) has the molecular formula C39H73NO4P- and a molecular weight of 650.99 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl [(5Z,8Z,27Z,30Z)-pentatriaconta-5,8,27,30-tetraen-18-yl] phosphate.
| Compound Name | 2-(dimethylamino)ethyl [(5Z,8Z,27Z,30Z)-pentatriaconta-5,8,27,30-tetraen-18-yl] phosphate |
|---|---|
| PubChem CID | 168800483 |
| Molecular Formula | C39H73NO4P- |
| Molecular Weight | 650.99 g/mol |
| Exact Mass | 650.53 |
| IUPAC Name | 2-(dimethylamino)ethyl [(5Z,8Z,27Z,30Z)-pentatriaconta-5,8,27,30-tetraen-18-yl] phosphate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCC)OP(=O)([O-])OCCN(C)C |
| InChI | InChI=1S/C39H74NO4P/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(44-45(41,42)43-38-37-40(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h11-14,17-20,39H,5-10,15-16,21-38H2,1-4H3,(H,41,42)/p-1/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ASARFIALMQHIKY-MAZCIEHSSA-M |
| XLogP | 12.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.99 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|