C41H75NO6 — CID 166495551
[3-[2-[3-(2-hexyldecanoyloxy)undecoxy]-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate (PubChem CID 166495551) has the molecular formula C41H75NO6 and a molecular weight of 678.05 g/mol. Its IUPAC name is [3-[2-[3-(2-hexyldecanoyloxy)undecoxy]-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate.
| Compound Name | [3-[2-[3-(2-hexyldecanoyloxy)undecoxy]-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166495551 |
| Molecular Formula | C41H75NO6 |
| Molecular Weight | 678.05 g/mol |
| Exact Mass | 677.56 |
| IUPAC Name | [3-[2-[3-(2-hexyldecanoyloxy)undecoxy]-2-oxoethyl]cyclopentyl] 1-methylpiperidine-4-carboxylate |
| SMILES | CCCCCCCCC(CCOC(=O)CC1CCC(OC(=O)C2CCN(C)CC2)C1)OC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C41H75NO6/c1-5-8-11-14-16-19-22-35(21-18-13-10-7-3)40(44)47-37(23-20-17-15-12-9-6-2)28-31-46-39(43)33-34-24-25-38(32-34)48-41(45)36-26-29-42(4)30-27-36/h34-38H,5-33H2,1-4H3 |
| InChIKey | OVRTZJGGRRFRJF-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.05 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|