C45H81NO2 — CID 134388249
[(5Z,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl] 2-(dimethylamino)cyclohexane-1-carboxylate (PubChem CID 134388249) has the molecular formula C45H81NO2 and a molecular weight of 668.15 g/mol. Its IUPAC name is [(5Z,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl] 2-(dimethylamino)cyclohexane-1-carboxylate.
| Compound Name | [(5Z,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl] 2-(dimethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134388249 |
| Molecular Formula | C45H81NO2 |
| Molecular Weight | 668.15 g/mol |
| Exact Mass | 667.63 |
| IUPAC Name | [(5Z,8Z,27Z,30Z)-hexatriaconta-5,8,27,30-tetraen-18-yl] 2-(dimethylamino)cyclohexane-1-carboxylate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)C1CCCCC1N(C)C |
| InChI | InChI=1S/C45H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-42(48-45(47)43-40-36-37-41-44(43)46(3)4)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h12-15,18-21,42-44H,5-11,16-17,22-41H2,1-4H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | SACNYLLXAWDXTD-QYCRHRGJSA-N |
| XLogP | 14.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.15 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|