C41H71NO2 — CID 139380967
[(4Z,23Z,26Z,29Z)-dotriaconta-1,4,23,26,29-pentaen-14-yl] 2-(dimethylamino)cyclohexane-1-carboxylate (PubChem CID 139380967) has the molecular formula C41H71NO2 and a molecular weight of 610.02 g/mol. Its IUPAC name is [(4Z,23Z,26Z,29Z)-dotriaconta-1,4,23,26,29-pentaen-14-yl] 2-(dimethylamino)cyclohexane-1-carboxylate.
| Compound Name | [(4Z,23Z,26Z,29Z)-dotriaconta-1,4,23,26,29-pentaen-14-yl] 2-(dimethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139380967 |
| Molecular Formula | C41H71NO2 |
| Molecular Weight | 610.02 g/mol |
| Exact Mass | 609.55 |
| IUPAC Name | [(4Z,23Z,26Z,29Z)-dotriaconta-1,4,23,26,29-pentaen-14-yl] 2-(dimethylamino)cyclohexane-1-carboxylate |
| SMILES | C=CC/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\C/C=C\CC)OC(=O)C1CCCCC1N(C)C |
| InChI | InChI=1S/C41H71NO2/c1-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-35-38(34-30-28-26-24-22-16-14-12-10-8-6-2)44-41(43)39-36-32-33-37-40(39)42(3)4/h6-7,9-10,12-13,15,18-19,38-40H,2,5,8,11,14,16-17,20-37H2,1,3-4H3/b9-7-,12-10-,15-13-,19-18- |
| InChIKey | CEDIRAAURJELTC-JTGVTNMASA-N |
| XLogP | 12.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.02 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|