C8H14ClNO3 — CID 121203887
2-chloro-1-(3-ethoxy-4-hydroxypyrrolidin-1-yl)ethanone (PubChem CID 121203887) has the molecular formula C8H14ClNO3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 2-chloro-1-(3-ethoxy-4-hydroxypyrrolidin-1-yl)ethanone.
| Compound Name | 2-chloro-1-(3-ethoxy-4-hydroxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 121203887 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-chloro-1-(3-ethoxy-4-hydroxypyrrolidin-1-yl)ethanone |
| SMILES | CCOC1CN(C(=O)CCl)CC1O |
| InChI | InChI=1S/C8H14ClNO3/c1-2-13-7-5-10(4-6(7)11)8(12)3-9/h6-7,11H,2-5H2,1H3 |
| InChIKey | FYTMUZCSUAHONM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|