C12H22N2O4 — CID 59451023
diethyl (3R,4S)-1-(2-aminoethyl)pyrrolidine-3,4-dicarboxylate (PubChem CID 59451023) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is diethyl (3R,4S)-1-(2-aminoethyl)pyrrolidine-3,4-dicarboxylate.
| Compound Name | diethyl (3R,4S)-1-(2-aminoethyl)pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 59451023 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | diethyl (3R,4S)-1-(2-aminoethyl)pyrrolidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CN(CCN)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C12H22N2O4/c1-3-17-11(15)9-7-14(6-5-13)8-10(9)12(16)18-4-2/h9-10H,3-8,13H2,1-2H3/t9-,10+ |
| InChIKey | DTGKZFKEMGZMAU-AOOOYVTPSA-N |
| XLogP | -0.38 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |