C13H30N4O — CID 111975347
2-[4-(dimethylamino)-2-ethoxybutyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111975347) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111975347 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CCOC(CCN(C)C)CN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C13H30N4O/c1-8-18-12(9-10-15(2)3)11-14-13(16(4)5)17(6)7/h12H,8-11H2,1-7H3 |
| InChIKey | NOBBDTZXLCIAIE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|