C13H31IN4O — CID 111975296
2-[4-(dimethylamino)-2-ethoxybutyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 111975296) has the molecular formula C13H31IN4O and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111975296 |
| Molecular Formula | C13H31IN4O |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCOC(CCN(C)C)C/N=C(\N)N(CC)CC.I |
| InChI | InChI=1S/C13H30N4O.HI/c1-6-17(7-2)13(14)15-11-12(18-8-3)9-10-16(4)5;/h12H,6-11H2,1-5H3,(H2,14,15);1H |
| InChIKey | MKLSPBNCVGVJFT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|