C16H36IN5O2 — CID 111975360
2-[4-(dimethylamino)-2-ethoxybutyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111975360) has the molecular formula C16H36IN5O2 and a molecular weight of 457.40 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-ethoxybutyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111975360 |
| Molecular Formula | C16H36IN5O2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCOC(CCN(C)C)C/N=C(\N)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C16H35N5O2.HI/c1-4-23-15(6-9-20(2)3)14-19-16(17)18-7-5-8-21-10-12-22-13-11-21;/h15H,4-14H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | KFRVHMXKONEOBY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|