C17H37IN6O — CID 111056058
2-[2-(4-ethylpiperazin-1-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111056058) has the molecular formula C17H37IN6O and a molecular weight of 468.43 g/mol. Its IUPAC name is 2-[2-(4-ethylpiperazin-1-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-ethylpiperazin-1-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111056058 |
| Molecular Formula | C17H37IN6O |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[2-(4-ethylpiperazin-1-yl)propyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(C(C)C/N=C(\N)NCCCN2CCOCC2)CC1.I |
| InChI | InChI=1S/C17H36N6O.HI/c1-3-21-7-9-23(10-8-21)16(2)15-20-17(18)19-5-4-6-22-11-13-24-14-12-22;/h16H,3-15H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | AMOYDAABJKUQAI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 69.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|