C16H35N5O — CID 111975291
2-[4-(dimethylamino)-2-ethoxybutyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111975291) has the molecular formula C16H35N5O and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-ethoxybutyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111975291 |
| Molecular Formula | C16H35N5O |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 2-[4-(dimethylamino)-2-ethoxybutyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCOC(CCN(C)C)C/N=C(\N)NCC1CCCN1CC |
| InChI | InChI=1S/C16H35N5O/c1-5-21-10-7-8-14(21)12-18-16(17)19-13-15(22-6-2)9-11-20(3)4/h14-15H,5-13H2,1-4H3,(H3,17,18,19) |
| InChIKey | FWSRGSPZAVMTTA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|