C15H33N5 — CID 111025935
2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111025935) has the molecular formula C15H33N5 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111025935 |
| Molecular Formula | C15H33N5 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 2-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/CC(C)(C)CN(C)C |
| InChI | InChI=1S/C15H33N5/c1-6-20-9-7-8-13(20)10-17-14(16)18-11-15(2,3)12-19(4)5/h13H,6-12H2,1-5H3,(H3,16,17,18) |
| InChIKey | QDYPCWDEQIOAEA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|