C15H28N6O — CID 111815806
2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111815806) has the molecular formula C15H28N6O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111815806 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H28N6O/c1-5-21-8-6-7-11(21)9-17-14(16)18-10-12-19-13(22-20-12)15(2,3)4/h11H,5-10H2,1-4H3,(H3,16,17,18) |
| InChIKey | CDULPLPIIPJGQK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|