C19H38IN5O2 — CID 111063039
tert-butyl 4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111063039) has the molecular formula C19H38IN5O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is tert-butyl 4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111063039 |
| Molecular Formula | C19H38IN5O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | tert-butyl 4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/CC1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C19H37N5O2.HI/c1-5-23-10-6-7-16(23)14-22-17(20)21-13-15-8-11-24(12-9-15)18(25)26-19(2,3)4;/h15-16H,5-14H2,1-4H3,(H3,20,21,22);1H |
| InChIKey | XLOUIITVMKNWQS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|