C12H28N2O — CID 115727472
N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine (PubChem CID 115727472) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115727472 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CCOC(CCN(C)C)CNC(C)CC |
| InChI | InChI=1S/C12H28N2O/c1-6-11(3)13-10-12(15-7-2)8-9-14(4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | UIQYAVRKGYHJSF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |