About N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine
N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine (PubChem CID 115727472) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
| PubChem CID | 115727472 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CCOC(CCN(C)C)CNC(C)CC |
| InChI | InChI=1S/C12H28N2O/c1-6-11(3)13-10-12(15-7-2)8-9-14(4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | UIQYAVRKGYHJSF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine?
The IUPAC name of N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine (CID 115727472) is N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine.
What is the SMILES notation for N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine?
The canonical SMILES for N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine is CCOC(CCN(C)C)CNC(C)CC.
What is the InChIKey of N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine?
The InChIKey is UIQYAVRKGYHJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O/c1-6-11(3)13-10-12(15-7-2)8-9-14(4)5/h11-13H,6-10H2,1-5H3.
What are the key properties of N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine?
N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine has a molecular weight of 216.37 g/mol, XLogP of 1.73, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-ethoxy-N',N'-dimethylbutane-1,4-diamine is sourced from PubChem (CID 115727472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).