C16H15F3N2O2 — CID 136775487
(E)-4-diazo-1-phenyl-3-(trifluoromethyl)non-2-ene-1,5-dione (PubChem CID 136775487) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is (E)-4-diazo-1-phenyl-3-(trifluoromethyl)non-2-ene-1,5-dione.
| Compound Name | (E)-4-diazo-1-phenyl-3-(trifluoromethyl)non-2-ene-1,5-dione |
|---|---|
| PubChem CID | 136775487 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (E)-4-diazo-1-phenyl-3-(trifluoromethyl)non-2-ene-1,5-dione |
| SMILES | CCCCC(=O)C(=[N+]=[N-])/C(=C\C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-3-9-13(22)15(21-20)12(16(17,18)19)10-14(23)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3/b12-10+ |
| InChIKey | FLYPAQWTLGZDDT-ZRDIBKRKSA-N |
| XLogP | 3.79 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|