C33H28N2O — CID 143868624
[9-ethyl-6-(5-phenylpent-4-ynimidoyl)carbazol-3-yl]-(2-methylphenyl)methanone (PubChem CID 143868624) has the molecular formula C33H28N2O and a molecular weight of 468.60 g/mol. Its IUPAC name is [9-ethyl-6-(5-phenylpent-4-ynimidoyl)carbazol-3-yl]-(2-methylphenyl)methanone.
| Compound Name | [9-ethyl-6-(5-phenylpent-4-ynimidoyl)carbazol-3-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 143868624 |
| Molecular Formula | C33H28N2O |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [9-ethyl-6-(5-phenylpent-4-ynimidoyl)carbazol-3-yl]-(2-methylphenyl)methanone |
| SMILES | [H]/N=C(\CCC#Cc1ccccc1)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C33H28N2O/c1-3-35-31-19-17-25(30(34)16-10-8-14-24-12-5-4-6-13-24)21-28(31)29-22-26(18-20-32(29)35)33(36)27-15-9-7-11-23(27)2/h4-7,9,11-13,15,17-22,34H,3,10,16H2,1-2H3/b34-30+ |
| InChIKey | ODNKDBXRPXXWNK-VBMGMRCRSA-N |
| XLogP | 7.55 |
| TPSA | 45.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|