C49H69N3O9 — CID 144922688
[(E)-[1-[4-[4-[(2E)-3-cyclohexyl-2-(2-cyclohexylacetyl)oxyiminopropanoyl]-2-nitrophenoxy]-3-(5-methylhexyl)phenyl]-1-oxopentan-2-ylidene]amino] 3-ethylhexanoate (PubChem CID 144922688) has the molecular formula C49H69N3O9 and a molecular weight of 844.10 g/mol. Its IUPAC name is [(E)-[1-[4-[4-[(2E)-3-cyclohexyl-2-(2-cyclohexylacetyl)oxyiminopropanoyl]-2-nitrophenoxy]-3-(5-methylhexyl)phenyl]-1-oxopentan-2-ylidene]amino] 3-ethylhexanoate.
| Compound Name | [(E)-[1-[4-[4-[(2E)-3-cyclohexyl-2-(2-cyclohexylacetyl)oxyiminopropanoyl]-2-nitrophenoxy]-3-(5-methylhexyl)phenyl]-1-oxopentan-2-ylidene]amino] 3-ethylhexanoate |
|---|---|
| PubChem CID | 144922688 |
| Molecular Formula | C49H69N3O9 |
| Molecular Weight | 844.10 g/mol |
| Exact Mass | 843.50 |
| IUPAC Name | [(E)-[1-[4-[4-[(2E)-3-cyclohexyl-2-(2-cyclohexylacetyl)oxyiminopropanoyl]-2-nitrophenoxy]-3-(5-methylhexyl)phenyl]-1-oxopentan-2-ylidene]amino] 3-ethylhexanoate |
| SMILES | CCC/C(=N\OC(=O)CC(CC)CCC)C(=O)c1ccc(Oc2ccc(C(=O)/C(CC3CCCCC3)=N/OC(=O)CC3CCCCC3)cc2[N+](=O)[O-])c(CCCCC(C)C)c1 |
| InChI | InChI=1S/C49H69N3O9/c1-6-17-35(8-3)30-46(53)60-50-41(18-7-2)48(55)39-25-27-44(38(32-39)24-16-15-19-34(4)5)59-45-28-26-40(33-43(45)52(57)58)49(56)42(29-36-20-11-9-12-21-36)51-61-47(54)31-37-22-13-10-14-23-37/h25-28,32-37H,6-24,29-31H2,1-5H3/b50-41+,51-42+ |
| InChIKey | VPXYWJCSNKLMQB-QFIAZDKJSA-N |
| XLogP | 12.88 |
| TPSA | 163.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.10 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|