C40H57N3O6S — CID 130265960
[(E)-1-[4-[4-[(Z)-C-(2-cyclohexylethyl)-N-(2-methylpropanoyloxy)carbonimidoyl]-2-nitrophenyl]sulfanyl-3-(5-methylhexyl)phenyl]butylideneamino] 2-methylpropanoate (PubChem CID 130265960) has the molecular formula C40H57N3O6S and a molecular weight of 707.98 g/mol. Its IUPAC name is [(E)-1-[4-[4-[(Z)-C-(2-cyclohexylethyl)-N-(2-methylpropanoyloxy)carbonimidoyl]-2-nitrophenyl]sulfanyl-3-(5-methylhexyl)phenyl]butylideneamino] 2-methylpropanoate.
| Compound Name | [(E)-1-[4-[4-[(Z)-C-(2-cyclohexylethyl)-N-(2-methylpropanoyloxy)carbonimidoyl]-2-nitrophenyl]sulfanyl-3-(5-methylhexyl)phenyl]butylideneamino] 2-methylpropanoate |
|---|---|
| PubChem CID | 130265960 |
| Molecular Formula | C40H57N3O6S |
| Molecular Weight | 707.98 g/mol |
| Exact Mass | 707.40 |
| IUPAC Name | [(E)-1-[4-[4-[(Z)-C-(2-cyclohexylethyl)-N-(2-methylpropanoyloxy)carbonimidoyl]-2-nitrophenyl]sulfanyl-3-(5-methylhexyl)phenyl]butylideneamino] 2-methylpropanoate |
| SMILES | CCC/C(=N\OC(=O)C(C)C)c1ccc(Sc2ccc(/C(CCC3CCCCC3)=N\OC(=O)C(C)C)cc2[N+](=O)[O-])c(CCCCC(C)C)c1 |
| InChI | InChI=1S/C40H57N3O6S/c1-8-14-34(41-48-39(44)28(4)5)31-20-23-37(33(25-31)18-13-12-15-27(2)3)50-38-24-21-32(26-36(38)43(46)47)35(42-49-40(45)29(6)7)22-19-30-16-10-9-11-17-30/h20-21,23-30H,8-19,22H2,1-7H3/b41-34+,42-35- |
| InChIKey | FGJATEZYESVZFH-YYHARJNFSA-N |
| XLogP | 11.08 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.98 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|