C36H48N2O7S2 — CID 162463686
[(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-4-methylsulfonyl-1-oxobutan-2-ylidene]amino] 3-propylsulfanylpropanoate (PubChem CID 162463686) has the molecular formula C36H48N2O7S2 and a molecular weight of 684.92 g/mol. Its IUPAC name is [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-4-methylsulfonyl-1-oxobutan-2-ylidene]amino] 3-propylsulfanylpropanoate.
| Compound Name | [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-4-methylsulfonyl-1-oxobutan-2-ylidene]amino] 3-propylsulfanylpropanoate |
|---|---|
| PubChem CID | 162463686 |
| Molecular Formula | C36H48N2O7S2 |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-4-methylsulfonyl-1-oxobutan-2-ylidene]amino] 3-propylsulfanylpropanoate |
| SMILES | CCCSCCC(=O)O/N=C(\CCS(C)(=O)=O)C(=O)c1ccc2c(c1)-c1cc(C(=O)C(C)(C)N3CCOCC3)ccc1C2(CC)CC |
| InChI | InChI=1S/C36H48N2O7S2/c1-7-20-46-21-14-32(39)45-37-31(15-22-47(6,42)43)33(40)25-10-12-29-27(23-25)28-24-26(11-13-30(28)36(29,8-2)9-3)34(41)35(4,5)38-16-18-44-19-17-38/h10-13,23-24H,7-9,14-22H2,1-6H3/b37-31+ |
| InChIKey | MECCSBQSGXKNOO-USLOJTSYSA-N |
| XLogP | 6.12 |
| TPSA | 119.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|