C30H43N3O5S — CID 162463486
[(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate (PubChem CID 162463486) has the molecular formula C30H43N3O5S and a molecular weight of 557.76 g/mol. Its IUPAC name is [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate.
| Compound Name | [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate |
|---|---|
| PubChem CID | 162463486 |
| Molecular Formula | C30H43N3O5S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate |
| SMILES | CCCCCCC(=O)O/N=C(\CCCS)C(=O)c1cn(CC)c2ccc(C(=O)C(C)(C)N3CCOCC3)cc12 |
| InChI | InChI=1S/C30H43N3O5S/c1-5-7-8-9-12-27(34)38-31-25(11-10-19-39)28(35)24-21-32(6-2)26-14-13-22(20-23(24)26)29(36)30(3,4)33-15-17-37-18-16-33/h13-14,20-21,39H,5-12,15-19H2,1-4H3/b31-25+ |
| InChIKey | JRBCNFVNWKKDLE-QCKNELIISA-N |
| XLogP | 5.72 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|