C33H41N3O4 — CID 162463492
[(E)-1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]oct-7-enylideneamino] benzoate (PubChem CID 162463492) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is [(E)-1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]oct-7-enylideneamino] benzoate.
| Compound Name | [(E)-1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]oct-7-enylideneamino] benzoate |
|---|---|
| PubChem CID | 162463492 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | [(E)-1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]oct-7-enylideneamino] benzoate |
| SMILES | C=CCCCCC/C(=N\OC(=O)c1ccccc1)c1cn(CC)c2ccc(C(=O)C(C)(C)N3CCOCC3)cc12 |
| InChI | InChI=1S/C33H41N3O4/c1-5-7-8-9-13-16-29(34-40-32(38)25-14-11-10-12-15-25)28-24-35(6-2)30-18-17-26(23-27(28)30)31(37)33(3,4)36-19-21-39-22-20-36/h5,10-12,14-15,17-18,23-24H,1,6-9,13,16,19-22H2,2-4H3/b34-29+ |
| InChIKey | LGOUHNYRILPRJZ-RIHQVDFKSA-N |
| XLogP | 6.65 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|