C38H49N3O4 — CID 162463796
[(E)-1-[4-(4-ethyl-N-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]anilino)phenyl]octylideneamino] acetate (PubChem CID 162463796) has the molecular formula C38H49N3O4 and a molecular weight of 611.83 g/mol. Its IUPAC name is [(E)-1-[4-(4-ethyl-N-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]anilino)phenyl]octylideneamino] acetate.
| Compound Name | [(E)-1-[4-(4-ethyl-N-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]anilino)phenyl]octylideneamino] acetate |
|---|---|
| PubChem CID | 162463796 |
| Molecular Formula | C38H49N3O4 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | [(E)-1-[4-(4-ethyl-N-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]anilino)phenyl]octylideneamino] acetate |
| SMILES | CCCCCCC/C(=N\OC(C)=O)c1ccc(N(c2ccc(CC)cc2)c2ccc(C(=O)C(C)(C)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C38H49N3O4/c1-6-8-9-10-11-12-36(39-45-29(3)42)31-15-21-34(22-16-31)41(33-19-13-30(7-2)14-20-33)35-23-17-32(18-24-35)37(43)38(4,5)40-25-27-44-28-26-40/h13-24H,6-12,25-28H2,1-5H3/b39-36+ |
| InChIKey | DZQVCUCSLYJEJZ-WQBMDMGNSA-N |
| XLogP | 8.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|