C32H35NO2 — CID 22929010
1-[4-[4-[2-(4-butylphenyl)ethynyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one (PubChem CID 22929010) has the molecular formula C32H35NO2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 1-[4-[4-[2-(4-butylphenyl)ethynyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one.
| Compound Name | 1-[4-[4-[2-(4-butylphenyl)ethynyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 22929010 |
| Molecular Formula | C32H35NO2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 1-[4-[4-[2-(4-butylphenyl)ethynyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
| SMILES | CCCCc1ccc(C#Cc2ccc(-c3ccc(C(=O)C(C)(C)N4CCOCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H35NO2/c1-4-5-6-25-7-9-26(10-8-25)11-12-27-13-15-28(16-14-27)29-17-19-30(20-18-29)31(34)32(2,3)33-21-23-35-24-22-33/h7-10,13-20H,4-6,21-24H2,1-3H3 |
| InChIKey | SCVOOZGONXOATD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|