C28H33NO2P2 — CID 159182083
1-[4-[4-[3,4-bis(phosphanylmethyl)phenyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one (PubChem CID 159182083) has the molecular formula C28H33NO2P2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 1-[4-[4-[3,4-bis(phosphanylmethyl)phenyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one.
| Compound Name | 1-[4-[4-[3,4-bis(phosphanylmethyl)phenyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 159182083 |
| Molecular Formula | C28H33NO2P2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-[4-[4-[3,4-bis(phosphanylmethyl)phenyl]phenyl]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(-c2ccc(-c3ccc(CP)c(CP)c3)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H33NO2P2/c1-28(2,29-13-15-31-16-14-29)27(30)23-9-7-21(8-10-23)20-3-5-22(6-4-20)24-11-12-25(18-32)26(17-24)19-33/h3-12,17H,13-16,18-19,32-33H2,1-2H3 |
| InChIKey | GKVWYDXKYYYZRJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|