C35H37N3O7 — CID 162463508
(6E)-6-acetyloxyimino-7-[9-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]carbazol-3-yl]-7-oxoheptanoic acid (PubChem CID 162463508) has the molecular formula C35H37N3O7 and a molecular weight of 611.69 g/mol. Its IUPAC name is (6E)-6-acetyloxyimino-7-[9-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]carbazol-3-yl]-7-oxoheptanoic acid.
| Compound Name | (6E)-6-acetyloxyimino-7-[9-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]carbazol-3-yl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 162463508 |
| Molecular Formula | C35H37N3O7 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (6E)-6-acetyloxyimino-7-[9-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]carbazol-3-yl]-7-oxoheptanoic acid |
| SMILES | CC(=O)O/N=C(\CCCCC(=O)O)C(=O)c1ccc2c(c1)c1ccccc1n2-c1ccc(C(=O)C(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C35H37N3O7/c1-23(39)45-36-29(9-5-7-11-32(40)41)33(42)25-14-17-31-28(22-25)27-8-4-6-10-30(27)38(31)26-15-12-24(13-16-26)34(43)35(2,3)37-18-20-44-21-19-37/h4,6,8,10,12-17,22H,5,7,9,11,18-21H2,1-3H3,(H,40,41)/b36-29+ |
| InChIKey | GGOCRNIRNWWBPV-ZONNCAFXSA-N |
| XLogP | 5.82 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|