C28H38N4O5 — CID 162463565
[(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-3-piperidin-4-ylpropan-2-ylidene]amino] acetate (PubChem CID 162463565) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-3-piperidin-4-ylpropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-3-piperidin-4-ylpropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 162463565 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | [(E)-[1-[1-ethyl-5-(2-methyl-2-morpholin-4-ylpropanoyl)indol-3-yl]-1-oxo-3-piperidin-4-ylpropan-2-ylidene]amino] acetate |
| SMILES | CCn1cc(C(=O)/C(CC2CCNCC2)=N/OC(C)=O)c2cc(C(=O)C(C)(C)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C28H38N4O5/c1-5-31-18-23(26(34)24(30-37-19(2)33)16-20-8-10-29-11-9-20)22-17-21(6-7-25(22)31)27(35)28(3,4)32-12-14-36-15-13-32/h6-7,17-18,20,29H,5,8-16H2,1-4H3/b30-24+ |
| InChIKey | MUNOMKTXRRSYHW-BGABXYSRSA-N |
| XLogP | 3.45 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|