C31H38N2O6S — CID 162463488
[(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 162463488) has the molecular formula C31H38N2O6S and a molecular weight of 566.72 g/mol. Its IUPAC name is [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 162463488 |
| Molecular Formula | C31H38N2O6S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\CC1CCCCC1O)C(=O)c1ccc(Sc2ccc(C(=O)C(C)(C)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C31H38N2O6S/c1-21(34)39-32-27(20-24-6-4-5-7-28(24)35)29(36)22-8-12-25(13-9-22)40-26-14-10-23(11-15-26)30(37)31(2,3)33-16-18-38-19-17-33/h8-15,24,28,35H,4-7,16-20H2,1-3H3/b32-27+ |
| InChIKey | HQFGGWXDBAPKCX-QVAGMWBUSA-N |
| XLogP | 5.17 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|