C29H31N3O7S — CID 162463612
(6E)-6-carbonocyanidoyloxyimino-7-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-7-oxoheptanoic acid (PubChem CID 162463612) has the molecular formula C29H31N3O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is (6E)-6-carbonocyanidoyloxyimino-7-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-7-oxoheptanoic acid.
| Compound Name | (6E)-6-carbonocyanidoyloxyimino-7-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 162463612 |
| Molecular Formula | C29H31N3O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | (6E)-6-carbonocyanidoyloxyimino-7-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-7-oxoheptanoic acid |
| SMILES | CC(C)(C(=O)c1ccc(Sc2ccc(C(=O)/C(CCCCC(=O)O)=N/OC(=O)C#N)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C29H31N3O7S/c1-29(2,32-15-17-38-18-16-32)28(37)21-9-13-23(14-10-21)40-22-11-7-20(8-12-22)27(36)24(31-39-26(35)19-30)5-3-4-6-25(33)34/h7-14H,3-6,15-18H2,1-2H3,(H,33,34)/b31-24+ |
| InChIKey | MNOVFMDGFUOKMI-QFMPWRQOSA-N |
| XLogP | 4.38 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|