C36H42N4O6 — CID 162463553
(6E)-6-carbonocyanidoyloxyimino-6-[5-cyclohexyl-1-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]indol-3-yl]hexanoic acid (PubChem CID 162463553) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is (6E)-6-carbonocyanidoyloxyimino-6-[5-cyclohexyl-1-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]indol-3-yl]hexanoic acid.
| Compound Name | (6E)-6-carbonocyanidoyloxyimino-6-[5-cyclohexyl-1-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 162463553 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | (6E)-6-carbonocyanidoyloxyimino-6-[5-cyclohexyl-1-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]indol-3-yl]hexanoic acid |
| SMILES | CC(C)(C(=O)c1ccc(-n2cc(/C(CCCCC(=O)O)=N/OC(=O)C#N)c3cc(C4CCCCC4)ccc32)cc1)N1CCOCC1 |
| InChI | InChI=1S/C36H42N4O6/c1-36(2,39-18-20-45-21-19-39)35(44)26-12-15-28(16-13-26)40-24-30(31(38-46-34(43)23-37)10-6-7-11-33(41)42)29-22-27(14-17-32(29)40)25-8-4-3-5-9-25/h12-17,22,24-25H,3-11,18-21H2,1-2H3,(H,41,42)/b38-31+ |
| InChIKey | NBWHPZRQOHXTRU-KPITYXSVSA-N |
| XLogP | 6.39 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|