C37H41N3O6S — CID 162463552
[(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-6-isocyanato-1-oxohexan-2-ylidene]amino] thiophene-2-carboxylate (PubChem CID 162463552) has the molecular formula C37H41N3O6S and a molecular weight of 655.82 g/mol. Its IUPAC name is [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-6-isocyanato-1-oxohexan-2-ylidene]amino] thiophene-2-carboxylate.
| Compound Name | [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-6-isocyanato-1-oxohexan-2-ylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 162463552 |
| Molecular Formula | C37H41N3O6S |
| Molecular Weight | 655.82 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | [(E)-[1-[9,9-diethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)fluoren-3-yl]-6-isocyanato-1-oxohexan-2-ylidene]amino] thiophene-2-carboxylate |
| SMILES | CCC1(CC)c2ccc(C(=O)/C(CCCCN=C=O)=N/OC(=O)c3cccs3)cc2-c2cc(C(=O)C(C)(C)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C37H41N3O6S/c1-5-37(6-2)29-14-12-25(33(42)31(10-7-8-16-38-24-41)39-46-35(44)32-11-9-21-47-32)22-27(29)28-23-26(13-15-30(28)37)34(43)36(3,4)40-17-19-45-20-18-40/h9,11-15,21-23H,5-8,10,16-20H2,1-4H3/b39-31+ |
| InChIKey | DYWMVFXRGLUDBB-KGHBKMJJSA-N |
| XLogP | 7.03 |
| TPSA | 114.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.82 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|