C20H33NO5SSi — CID 58085412
2-methyl-2-morpholin-4-yl-1-[4-(3-trimethoxysilylpropylsulfanyl)phenyl]propan-1-one (PubChem CID 58085412) has the molecular formula C20H33NO5SSi and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-methyl-2-morpholin-4-yl-1-[4-(3-trimethoxysilylpropylsulfanyl)phenyl]propan-1-one.
| Compound Name | 2-methyl-2-morpholin-4-yl-1-[4-(3-trimethoxysilylpropylsulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 58085412 |
| Molecular Formula | C20H33NO5SSi |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-methyl-2-morpholin-4-yl-1-[4-(3-trimethoxysilylpropylsulfanyl)phenyl]propan-1-one |
| SMILES | CO[Si](CCCSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1)(OC)OC |
| InChI | InChI=1S/C20H33NO5SSi/c1-20(2,21-11-13-26-14-12-21)19(22)17-7-9-18(10-8-17)27-15-6-16-28(23-3,24-4)25-5/h7-10H,6,11-16H2,1-5H3 |
| InChIKey | IRFHJOOMIXIFMU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|