C35H32N2O5S — CID 123494002
[[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate (PubChem CID 123494002) has the molecular formula C35H32N2O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is [[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate.
| Compound Name | [[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 123494002 |
| Molecular Formula | C35H32N2O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | [[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)ON=C(C(=O)c1ccc(Sc2ccc(C(=O)c3ccc(N4CCOCC4)cc3)cc2)cc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C35H32N2O5S/c1-23-4-5-24(2)32(22-23)33(36-42-25(3)38)35(40)28-10-16-31(17-11-28)43-30-14-8-27(9-15-30)34(39)26-6-12-29(13-7-26)37-18-20-41-21-19-37/h4-17,22H,18-21H2,1-3H3 |
| InChIKey | VCDUKNGAVRSSFW-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|