C31H25NO4S — CID 174977486
[[2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate (PubChem CID 174977486) has the molecular formula C31H25NO4S and a molecular weight of 507.61 g/mol. Its IUPAC name is [[2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate.
| Compound Name | [[2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 174977486 |
| Molecular Formula | C31H25NO4S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [[2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)ON=C(C(=O)c1ccc(Sc2ccc(C(=O)c3ccccc3C)cc2)cc1)c1ccccc1C |
| InChI | InChI=1S/C31H25NO4S/c1-20-8-4-6-10-27(20)29(32-36-22(3)33)31(35)24-14-18-26(19-15-24)37-25-16-12-23(13-17-25)30(34)28-11-7-5-9-21(28)2/h4-19H,1-3H3 |
| InChIKey | QBEYHCBVIGDRKR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|