C29H30ClN3O4S — CID 155358942
[(Z)-[1-chloro-2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] N-(hexylamino)carbamate (PubChem CID 155358942) has the molecular formula C29H30ClN3O4S and a molecular weight of 552.10 g/mol. Its IUPAC name is [(Z)-[1-chloro-2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] N-(hexylamino)carbamate.
| Compound Name | [(Z)-[1-chloro-2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] N-(hexylamino)carbamate |
|---|---|
| PubChem CID | 155358942 |
| Molecular Formula | C29H30ClN3O4S |
| Molecular Weight | 552.10 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [(Z)-[1-chloro-2-[4-[4-(2-methylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] N-(hexylamino)carbamate |
| SMILES | CCCCCCNNC(=O)O/N=C(\Cl)C(=O)c1ccc(Sc2ccc(C(=O)c3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C29H30ClN3O4S/c1-3-4-5-8-19-31-32-29(36)37-33-28(30)27(35)22-13-17-24(18-14-22)38-23-15-11-21(12-16-23)26(34)25-10-7-6-9-20(25)2/h6-7,9-18,31H,3-5,8,19H2,1-2H3,(H,32,36)/b33-28- |
| InChIKey | RFTNWXGYFUDBBH-MDVFONAFSA-N |
| XLogP | 6.92 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.10 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|