C32H23NO3S — CID 118360147
(2Z)-2-hydroxyimino-2-(2-methylphenyl)-1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]ethanone (PubChem CID 118360147) has the molecular formula C32H23NO3S and a molecular weight of 501.61 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-2-(2-methylphenyl)-1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]ethanone.
| Compound Name | (2Z)-2-hydroxyimino-2-(2-methylphenyl)-1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]ethanone |
|---|---|
| PubChem CID | 118360147 |
| Molecular Formula | C32H23NO3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (2Z)-2-hydroxyimino-2-(2-methylphenyl)-1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]ethanone |
| SMILES | Cc1ccccc1/C(=N/O)C(=O)c1ccc(Sc2ccc(C(=O)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C32H23NO3S/c1-21-6-2-5-9-29(21)30(33-36)32(35)24-14-18-28(19-15-24)37-27-16-12-23(13-17-27)31(34)26-11-10-22-7-3-4-8-25(22)20-26/h2-20,36H,1H3/b33-30- |
| InChIKey | VAWGFLDJLUYUQO-MEIHLTSWSA-N |
| XLogP | 7.59 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|