C39H40N2O5S — CID 144983520
(Z)-but-2-ene;[(Z)-[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate (PubChem CID 144983520) has the molecular formula C39H40N2O5S and a molecular weight of 648.83 g/mol. Its IUPAC name is (Z)-but-2-ene;[(Z)-[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate.
| Compound Name | (Z)-but-2-ene;[(Z)-[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 144983520 |
| Molecular Formula | C39H40N2O5S |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | (Z)-but-2-ene;[(Z)-[1-(2,5-dimethylphenyl)-2-[4-[4-(4-morpholin-4-ylbenzoyl)phenyl]sulfanylphenyl]-2-oxoethylidene]amino] acetate |
| SMILES | C/C=C\C.CC(=O)O/N=C(\C(=O)c1ccc(Sc2ccc(C(=O)c3ccc(N4CCOCC4)cc3)cc2)cc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C35H32N2O5S.C4H8/c1-23-4-5-24(2)32(22-23)33(36-42-25(3)38)35(40)28-10-16-31(17-11-28)43-30-14-8-27(9-15-30)34(39)26-6-12-29(13-7-26)37-18-20-41-21-19-37;1-3-4-2/h4-17,22H,18-21H2,1-3H3;3-4H,1-2H3/b36-33-;4-3- |
| InChIKey | LYDFXVOGQVUOMX-HFEDBTNBSA-N |
| XLogP | 8.25 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|