C22H26N2O4 — CID 88903463
[(E)-[(4Z)-1-(4-morpholin-4-ylphenyl)-1-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-ylidene]amino] acetate (PubChem CID 88903463) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(E)-[(4Z)-1-(4-morpholin-4-ylphenyl)-1-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-ylidene]amino] acetate.
| Compound Name | [(E)-[(4Z)-1-(4-morpholin-4-ylphenyl)-1-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 88903463 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(E)-[(4Z)-1-(4-morpholin-4-ylphenyl)-1-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-2-ylidene]amino] acetate |
| SMILES | C=C/C=C(\C=C/C)C/C(=N\OC(C)=O)C(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-4-6-18(7-5-2)16-21(23-28-17(3)25)22(26)19-8-10-20(11-9-19)24-12-14-27-15-13-24/h4-11H,1,12-16H2,2-3H3/b7-5-,18-6+,23-21+ |
| InChIKey | PEKHHBYGVZZVKN-NMHBVOMQSA-N |
| XLogP | 3.70 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|