C24H28N2O2 — CID 21292693
4-[4-[1-(4-morpholin-4-ylphenyl)buta-1,3-dienyl]phenyl]morpholine (PubChem CID 21292693) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[4-[1-(4-morpholin-4-ylphenyl)buta-1,3-dienyl]phenyl]morpholine.
| Compound Name | 4-[4-[1-(4-morpholin-4-ylphenyl)buta-1,3-dienyl]phenyl]morpholine |
|---|---|
| PubChem CID | 21292693 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[4-[1-(4-morpholin-4-ylphenyl)buta-1,3-dienyl]phenyl]morpholine |
| SMILES | C=CC=C(c1ccc(N2CCOCC2)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-2-3-24(20-4-8-22(9-5-20)25-12-16-27-17-13-25)21-6-10-23(11-7-21)26-14-18-28-19-15-26/h2-11H,1,12-19H2 |
| InChIKey | UIHFDGJHHUZTBJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|