C43H51ClN4O4 — CID 173333244
4-[4-[1,3,3-tris(4-morpholin-4-ylphenyl)prop-1-enyl]phenyl]morpholine;hydrochloride (PubChem CID 173333244) has the molecular formula C43H51ClN4O4 and a molecular weight of 723.36 g/mol. Its IUPAC name is 4-[4-[1,3,3-tris(4-morpholin-4-ylphenyl)prop-1-enyl]phenyl]morpholine;hydrochloride.
| Compound Name | 4-[4-[1,3,3-tris(4-morpholin-4-ylphenyl)prop-1-enyl]phenyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 173333244 |
| Molecular Formula | C43H51ClN4O4 |
| Molecular Weight | 723.36 g/mol |
| Exact Mass | 722.36 |
| IUPAC Name | 4-[4-[1,3,3-tris(4-morpholin-4-ylphenyl)prop-1-enyl]phenyl]morpholine;hydrochloride |
| SMILES | C(=C(c1ccc(N2CCOCC2)cc1)c1ccc(N2CCOCC2)cc1)C(c1ccc(N2CCOCC2)cc1)c1ccc(N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C43H50N4O4.ClH/c1-9-38(44-17-25-48-26-18-44)10-2-34(1)42(35-3-11-39(12-4-35)45-19-27-49-28-20-45)33-43(36-5-13-40(14-6-36)46-21-29-50-30-22-46)37-7-15-41(16-8-37)47-23-31-51-32-24-47;/h1-16,33,42H,17-32H2;1H |
| InChIKey | JHZXCKFWRKZFFP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.36 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|